C10H10O2 — CID 55250645
(1S,7R)-5-hydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 55250645) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,7R)-5-hydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,7R)-5-hydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 55250645 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1S,7R)-5-hydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C=C(O)C2C1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H10O2/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10/h1-2,4-6,9-11H,3H2/t5-,6+,9?,10?/m0/s1 |
| InChIKey | FJTCWKUCNYGDQY-VUJPYCBQSA-N |
| XLogP | 1.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|