About 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one
7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 55250652) has the molecular formula C9H8FNO2
and a molecular weight of 181.17 g/mol. Its IUPAC name is 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| PubChem CID | 55250652 |
| Molecular Formula | C9H8FNO2 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOc2ccc(F)cc21 |
| InChI | InChI=1S/C9H8FNO2/c10-6-1-2-8-7(5-6)9(12)11-3-4-13-8/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | YXOJHOVPKUPGIZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The IUPAC name of 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CID 55250652) is 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The canonical SMILES for 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one is O=C1NCCOc2ccc(F)cc21.
What is the InChIKey of 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The InChIKey is YXOJHOVPKUPGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2/c10-6-1-2-8-7(5-6)9(12)11-3-4-13-8/h1-2,5H,3-4H2,(H,11,12).
What are the key properties of 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one has a molecular weight of 181.17 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 55250652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).