About 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid
2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid (PubChem CID 55250681) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid |
| PubChem CID | 55250681 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid |
| SMILES | Cc1nn(C)cc1CC(N)C(=O)O |
| InChI | InChI=1S/C8H13N3O2/c1-5-6(4-11(2)10-5)3-7(9)8(12)13/h4,7H,3,9H2,1-2H3,(H,12,13) |
| InChIKey | ZNQBUYCNGJNQQV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid (CID 55250681) is 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid is Cc1nn(C)cc1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid?
The InChIKey is ZNQBUYCNGJNQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5-6(4-11(2)10-5)3-7(9)8(12)13/h4,7H,3,9H2,1-2H3,(H,12,13).
What are the key properties of 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid?
2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid has a molecular weight of 183.21 g/mol, XLogP of -0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,3-dimethylpyrazol-4-yl)propanoic acid is sourced from PubChem (CID 55250681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).