2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid

C9H15N3O2 — CID 55250702

IUPAC2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid
SMILESCc1nn(C)c(C)c1CC(N)C(=O)O
InChIInChI=1S/C9H15N3O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h8H,4,10H2,1-3H3,(H,13,14)
InChIKeyFQAMFWDNLANSTP-UHFFFAOYSA-N
MW197.24 g/mol
LogP-0.01
Rot. Bonds3

About 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid

2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid (PubChem CID 55250702) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid
PubChem CID55250702
Molecular FormulaC9H15N3O2
Molecular Weight197.24 g/mol
Exact Mass197.12
IUPAC Name2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid
SMILESCc1nn(C)c(C)c1CC(N)C(=O)O
InChIInChI=1S/C9H15N3O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h8H,4,10H2,1-3H3,(H,13,14)
InChIKeyFQAMFWDNLANSTP-UHFFFAOYSA-N
XLogP-0.01
TPSA81.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.24
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid (CID 55250702) is 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid is Cc1nn(C)c(C)c1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid?
The InChIKey is FQAMFWDNLANSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-5-7(4-8(10)9(13)14)6(2)12(3)11-5/h8H,4,10H2,1-3H3,(H,13,14).
What are the key properties of 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid?
2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid has a molecular weight of 197.24 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid is sourced from PubChem (CID 55250702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).