About 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine
3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine (PubChem CID 55251447) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine |
| PubChem CID | 55251447 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine |
| SMILES | C=CCN(CC=C)CCCOC1CCNCC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-10-16(11-4-2)12-5-13-17-14-6-8-15-9-7-14/h3-4,14-15H,1-2,5-13H2 |
| InChIKey | YVLHYOJOSJGIIS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine?
The IUPAC name of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine (CID 55251447) is 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine.
What is the SMILES notation for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine?
The canonical SMILES for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine is C=CCN(CC=C)CCCOC1CCNCC1.
What is the InChIKey of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine?
The InChIKey is YVLHYOJOSJGIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-3-10-16(11-4-2)12-5-13-17-14-6-8-15-9-7-14/h3-4,14-15H,1-2,5-13H2.
What are the key properties of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine?
3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine has a molecular weight of 238.37 g/mol, XLogP of 1.82, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propan-1-amine is sourced from PubChem (CID 55251447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).