C12H12F2N4 — CID 55251714
4-(3,5-difluorophenyl)-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 55251714) has the molecular formula C12H12F2N4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,5-difluorophenyl)-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55251714 |
| Molecular Formula | C12H12F2N4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(3,5-difluorophenyl)-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N)nc(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C12H12F2N4/c1-6(2)10-16-11(18-12(15)17-10)7-3-8(13)5-9(14)4-7/h3-6H,1-2H3,(H2,15,16,17,18) |
| InChIKey | CLAWTEZLQFHLCS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |