C15H30N2O2 — CID 55251825
3,4,4-trimethyl-N-(2-piperidin-4-yloxyethyl)pentanamide (PubChem CID 55251825) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3,4,4-trimethyl-N-(2-piperidin-4-yloxyethyl)pentanamide.
| Compound Name | 3,4,4-trimethyl-N-(2-piperidin-4-yloxyethyl)pentanamide |
|---|---|
| PubChem CID | 55251825 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3,4,4-trimethyl-N-(2-piperidin-4-yloxyethyl)pentanamide |
| SMILES | CC(CC(=O)NCCOC1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-12(15(2,3)4)11-14(18)17-9-10-19-13-5-7-16-8-6-13/h12-13,16H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | AYKDAMZEUAHGHD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|