About 2-chloro-8-methyl-6,7-dihydro-5H-pteridine
2-chloro-8-methyl-6,7-dihydro-5H-pteridine (PubChem CID 55252657) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 2-chloro-8-methyl-6,7-dihydro-5H-pteridine.
Molecular Properties
| Compound Name | 2-chloro-8-methyl-6,7-dihydro-5H-pteridine |
| PubChem CID | 55252657 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-chloro-8-methyl-6,7-dihydro-5H-pteridine |
| SMILES | CN1CCNc2cnc(Cl)nc21 |
| InChI | InChI=1S/C7H9ClN4/c1-12-3-2-9-5-4-10-7(8)11-6(5)12/h4,9H,2-3H2,1H3 |
| InChIKey | JAOCALWYCRAAPN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-8-methyl-6,7-dihydro-5H-pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-8-methyl-6,7-dihydro-5H-pteridine?
The IUPAC name of 2-chloro-8-methyl-6,7-dihydro-5H-pteridine (CID 55252657) is 2-chloro-8-methyl-6,7-dihydro-5H-pteridine.
What is the SMILES notation for 2-chloro-8-methyl-6,7-dihydro-5H-pteridine?
The canonical SMILES for 2-chloro-8-methyl-6,7-dihydro-5H-pteridine is CN1CCNc2cnc(Cl)nc21.
What is the InChIKey of 2-chloro-8-methyl-6,7-dihydro-5H-pteridine?
The InChIKey is JAOCALWYCRAAPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4/c1-12-3-2-9-5-4-10-7(8)11-6(5)12/h4,9H,2-3H2,1H3.
What are the key properties of 2-chloro-8-methyl-6,7-dihydro-5H-pteridine?
2-chloro-8-methyl-6,7-dihydro-5H-pteridine has a molecular weight of 184.63 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-8-methyl-6,7-dihydro-5H-pteridine is sourced from PubChem (CID 55252657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).