About 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine
6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine (PubChem CID 55252713) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
| PubChem CID | 55252713 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
| SMILES | COc1ccc2c(n1)N(C)CCN2 |
| InChI | InChI=1S/C9H13N3O/c1-12-6-5-10-7-3-4-8(13-2)11-9(7)12/h3-4,10H,5-6H2,1-2H3 |
| InChIKey | MVJFDYAUHNPRBE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine?
The IUPAC name of 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine (CID 55252713) is 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine.
What is the SMILES notation for 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine?
The canonical SMILES for 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine is COc1ccc2c(n1)N(C)CCN2.
What is the InChIKey of 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine?
The InChIKey is MVJFDYAUHNPRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-12-6-5-10-7-3-4-8(13-2)11-9(7)12/h3-4,10H,5-6H2,1-2H3.
What are the key properties of 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine?
6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine has a molecular weight of 179.22 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine is sourced from PubChem (CID 55252713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).