About 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one
6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 55252766) has the molecular formula C8H8ClN3O
and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| PubChem CID | 55252766 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | CN1CC(=O)Nc2ccc(Cl)nc21 |
| InChI | InChI=1S/C8H8ClN3O/c1-12-4-7(13)10-5-2-3-6(9)11-8(5)12/h2-3H,4H2,1H3,(H,10,13) |
| InChIKey | XWNWOOKEOAQUGP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one?
The IUPAC name of 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one (CID 55252766) is 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one.
What is the SMILES notation for 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one?
The canonical SMILES for 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one is CN1CC(=O)Nc2ccc(Cl)nc21.
What is the InChIKey of 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one?
The InChIKey is XWNWOOKEOAQUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O/c1-12-4-7(13)10-5-2-3-6(9)11-8(5)12/h2-3H,4H2,1H3,(H,10,13).
What are the key properties of 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one?
6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one has a molecular weight of 197.62 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-methyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one is sourced from PubChem (CID 55252766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).