C8H6FN3O — CID 55252832
N-(6-cyano-5-fluoro-2-pyridinyl)acetamide (PubChem CID 55252832) has the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. Its IUPAC name is N-(6-cyano-5-fluoro-2-pyridinyl)acetamide.
| Compound Name | N-(6-cyano-5-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 55252832 |
| Molecular Formula | C8H6FN3O |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | N-(6-cyano-5-fluoro-2-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(C#N)n1 |
| InChI | InChI=1S/C8H6FN3O/c1-5(13)11-8-3-2-6(9)7(4-10)12-8/h2-3H,1H3,(H,11,12,13) |
| InChIKey | WCTZIPDNUGIYSO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |