C10H11F2N — CID 55253125
6,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 55253125) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 6,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 6,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 55253125 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 6,8-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | NC1CCCc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C10H11F2N/c11-7-4-6-2-1-3-9(13)10(6)8(12)5-7/h4-5,9H,1-3,13H2 |
| InChIKey | GTZDIEIDYINPIO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |