C10H14FNO2 — CID 55253176
2-(2,2-dimethoxyethyl)-4-fluoroaniline (PubChem CID 55253176) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-4-fluoroaniline.
| Compound Name | 2-(2,2-dimethoxyethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 55253176 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-4-fluoroaniline |
| SMILES | COC(Cc1cc(F)ccc1N)OC |
| InChI | InChI=1S/C10H14FNO2/c1-13-10(14-2)6-7-5-8(11)3-4-9(7)12/h3-5,10H,6,12H2,1-2H3 |
| InChIKey | WNAPKZNZAQIGDB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|