About 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine
5-(2-aminoethyl)-N,N-dimethylfuran-2-amine (PubChem CID 55253433) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine |
| PubChem CID | 55253433 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine |
| SMILES | CN(C)c1ccc(CCN)o1 |
| InChI | InChI=1S/C8H14N2O/c1-10(2)8-4-3-7(11-8)5-6-9/h3-4H,5-6,9H2,1-2H3 |
| InChIKey | WTBUHUYLLWKBAZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine?
The IUPAC name of 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine (CID 55253433) is 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine.
What is the SMILES notation for 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine?
The canonical SMILES for 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine is CN(C)c1ccc(CCN)o1.
What is the InChIKey of 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine?
The InChIKey is WTBUHUYLLWKBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10(2)8-4-3-7(11-8)5-6-9/h3-4H,5-6,9H2,1-2H3.
What are the key properties of 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine?
5-(2-aminoethyl)-N,N-dimethylfuran-2-amine has a molecular weight of 154.21 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-N,N-dimethylfuran-2-amine is sourced from PubChem (CID 55253433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).