About 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride
2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride (PubChem CID 55253535) has the molecular formula C7H9ClF2N2
and a molecular weight of 194.61 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride |
| PubChem CID | 55253535 |
| Molecular Formula | C7H9ClF2N2 |
| Molecular Weight | 194.61 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1c(F)cncc1F |
| InChI | InChI=1S/C7H8F2N2.ClH/c8-6-3-11-4-7(9)5(6)1-2-10;/h3-4H,1-2,10H2;1H |
| InChIKey | MHCRJNBUEGXDFN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride?
The IUPAC name of 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride (CID 55253535) is 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride?
The canonical SMILES for 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride is Cl.NCCc1c(F)cncc1F.
What is the InChIKey of 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride?
The InChIKey is MHCRJNBUEGXDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2.ClH/c8-6-3-11-4-7(9)5(6)1-2-10;/h3-4H,1-2,10H2;1H.
What are the key properties of 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride?
2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride has a molecular weight of 194.61 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluoro-4-pyridinyl)ethanamine;hydrochloride is sourced from PubChem (CID 55253535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).