About 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol
2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol (PubChem CID 55254054) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol |
| PubChem CID | 55254054 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol |
| SMILES | NC(CO)CC1=COCCC1 |
| InChI | InChI=1S/C8H15NO2/c9-8(5-10)4-7-2-1-3-11-6-7/h6,8,10H,1-5,9H2 |
| InChIKey | OFFURJRERMDECH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol?
The IUPAC name of 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol (CID 55254054) is 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol.
What is the SMILES notation for 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol?
The canonical SMILES for 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol is NC(CO)CC1=COCCC1.
What is the InChIKey of 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol?
The InChIKey is OFFURJRERMDECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c9-8(5-10)4-7-2-1-3-11-6-7/h6,8,10H,1-5,9H2.
What are the key properties of 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol?
2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol has a molecular weight of 157.21 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3,4-dihydro-2H-pyran-5-yl)propan-1-ol is sourced from PubChem (CID 55254054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).