About 2-(2-aminoethyl)-3,4-difluoroaniline
2-(2-aminoethyl)-3,4-difluoroaniline (PubChem CID 55254324) has the molecular formula C8H10F2N2
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-(2-aminoethyl)-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-3,4-difluoroaniline |
| PubChem CID | 55254324 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-(2-aminoethyl)-3,4-difluoroaniline |
| SMILES | NCCc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C8H10F2N2/c9-6-1-2-7(12)5(3-4-11)8(6)10/h1-2H,3-4,11-12H2 |
| InChIKey | KZYIGQCFVVVTRO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyl)-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-3,4-difluoroaniline?
The IUPAC name of 2-(2-aminoethyl)-3,4-difluoroaniline (CID 55254324) is 2-(2-aminoethyl)-3,4-difluoroaniline.
What is the SMILES notation for 2-(2-aminoethyl)-3,4-difluoroaniline?
The canonical SMILES for 2-(2-aminoethyl)-3,4-difluoroaniline is NCCc1c(N)ccc(F)c1F.
What is the InChIKey of 2-(2-aminoethyl)-3,4-difluoroaniline?
The InChIKey is KZYIGQCFVVVTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2/c9-6-1-2-7(12)5(3-4-11)8(6)10/h1-2H,3-4,11-12H2.
What are the key properties of 2-(2-aminoethyl)-3,4-difluoroaniline?
2-(2-aminoethyl)-3,4-difluoroaniline has a molecular weight of 172.18 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-3,4-difluoroaniline is sourced from PubChem (CID 55254324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).