C7H10N2O — CID 55254748
4,5,6,7-tetrahydro-1H-indazol-5-ol (PubChem CID 55254748) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-indazol-5-ol.
| Compound Name | 4,5,6,7-tetrahydro-1H-indazol-5-ol |
|---|---|
| PubChem CID | 55254748 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 4,5,6,7-tetrahydro-1H-indazol-5-ol |
| SMILES | OC1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C7H10N2O/c10-6-1-2-7-5(3-6)4-8-9-7/h4,6,10H,1-3H2,(H,8,9) |
| InChIKey | YVLDNKIONGZQBC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |