About (Z)-dec-7-en-3-amine
(Z)-dec-7-en-3-amine (PubChem CID 55254863) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is (Z)-dec-7-en-3-amine.
Molecular Properties
| Compound Name | (Z)-dec-7-en-3-amine |
| PubChem CID | 55254863 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (Z)-dec-7-en-3-amine |
| SMILES | CC/C=C\CCCC(N)CC |
| InChI | InChI=1S/C10H21N/c1-3-5-6-7-8-9-10(11)4-2/h5-6,10H,3-4,7-9,11H2,1-2H3/b6-5- |
| InChIKey | HVPZRPOEYRAHEJ-WAYWQWQTSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-dec-7-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-dec-7-en-3-amine?
The IUPAC name of (Z)-dec-7-en-3-amine (CID 55254863) is (Z)-dec-7-en-3-amine.
What is the SMILES notation for (Z)-dec-7-en-3-amine?
The canonical SMILES for (Z)-dec-7-en-3-amine is CC/C=C\CCCC(N)CC.
What is the InChIKey of (Z)-dec-7-en-3-amine?
The InChIKey is HVPZRPOEYRAHEJ-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H21N/c1-3-5-6-7-8-9-10(11)4-2/h5-6,10H,3-4,7-9,11H2,1-2H3/b6-5-.
What are the key properties of (Z)-dec-7-en-3-amine?
(Z)-dec-7-en-3-amine has a molecular weight of 155.28 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-dec-7-en-3-amine is sourced from PubChem (CID 55254863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).