About (1S,7R)-4-azatricyclo[5.2.1.02,6]decane
(1S,7R)-4-azatricyclo[5.2.1.02,6]decane (PubChem CID 55254914) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (1S,7R)-4-azatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | (1S,7R)-4-azatricyclo[5.2.1.02,6]decane |
| PubChem CID | 55254914 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1S,7R)-4-azatricyclo[5.2.1.02,6]decane |
| SMILES | C1NCC2C1[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C9H15N/c1-2-7-3-6(1)8-4-10-5-9(7)8/h6-10H,1-5H2/t6-,7+,8?,9? |
| InChIKey | VBSDAMAWZZSZMY-QPIHLSAKSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,7R)-4-azatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,7R)-4-azatricyclo[5.2.1.02,6]decane?
The IUPAC name of (1S,7R)-4-azatricyclo[5.2.1.02,6]decane (CID 55254914) is (1S,7R)-4-azatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for (1S,7R)-4-azatricyclo[5.2.1.02,6]decane?
The canonical SMILES for (1S,7R)-4-azatricyclo[5.2.1.02,6]decane is C1NCC2C1[C@@H]1CC[C@H]2C1.
What is the InChIKey of (1S,7R)-4-azatricyclo[5.2.1.02,6]decane?
The InChIKey is VBSDAMAWZZSZMY-QPIHLSAKSA-N. The full InChI is InChI=1S/C9H15N/c1-2-7-3-6(1)8-4-10-5-9(7)8/h6-10H,1-5H2/t6-,7+,8?,9?.
What are the key properties of (1S,7R)-4-azatricyclo[5.2.1.02,6]decane?
(1S,7R)-4-azatricyclo[5.2.1.02,6]decane has a molecular weight of 137.23 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,7R)-4-azatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 55254914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).