About 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole
8-fluoro-4H-chromeno[3,4-d][1,2]oxazole (PubChem CID 55255299) has the molecular formula C10H6FNO2
and a molecular weight of 191.16 g/mol. Its IUPAC name is 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole.
Molecular Properties
| Compound Name | 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole |
| PubChem CID | 55255299 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole |
| SMILES | Fc1ccc2c(c1)-c1oncc1CO2 |
| InChI | InChI=1S/C10H6FNO2/c11-7-1-2-9-8(3-7)10-6(5-13-9)4-12-14-10/h1-4H,5H2 |
| InChIKey | HLXGFCLKWCQDRJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole?
The IUPAC name of 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole (CID 55255299) is 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole.
What is the SMILES notation for 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole?
The canonical SMILES for 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole is Fc1ccc2c(c1)-c1oncc1CO2.
What is the InChIKey of 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole?
The InChIKey is HLXGFCLKWCQDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FNO2/c11-7-1-2-9-8(3-7)10-6(5-13-9)4-12-14-10/h1-4H,5H2.
What are the key properties of 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole?
8-fluoro-4H-chromeno[3,4-d][1,2]oxazole has a molecular weight of 191.16 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4H-chromeno[3,4-d][1,2]oxazole is sourced from PubChem (CID 55255299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).