C6H7FN2O2 — CID 55255457
5-(aminomethyl)-3-fluoro-6-hydroxy-1H-pyridin-2-one (PubChem CID 55255457) has the molecular formula C6H7FN2O2 and a molecular weight of 158.13 g/mol. Its IUPAC name is 5-(aminomethyl)-3-fluoro-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 5-(aminomethyl)-3-fluoro-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 55255457 |
| Molecular Formula | C6H7FN2O2 |
| Molecular Weight | 158.13 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 5-(aminomethyl)-3-fluoro-6-hydroxy-1H-pyridin-2-one |
| SMILES | NCc1cc(F)c(=O)[nH]c1O |
| InChI | InChI=1S/C6H7FN2O2/c7-4-1-3(2-8)5(10)9-6(4)11/h1H,2,8H2,(H2,9,10,11) |
| InChIKey | DDDOQJPJQBREBQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |