About (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol
(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol (PubChem CID 55255541) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol.
Molecular Properties
| Compound Name | (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol |
| PubChem CID | 55255541 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol |
| SMILES | OC1NC2C[C@@H]3CC1C[C@@H](C2)C3 |
| InChI | InChI=1S/C10H17NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-12H,1-5H2/t6-,7-,8?,9?,10?/m0/s1 |
| InChIKey | MAPYNHQXIRMQAC-JXSKLUPZSA-N |
| XLogP | 1.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol?
The IUPAC name of (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol (CID 55255541) is (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol.
What is the SMILES notation for (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol?
The canonical SMILES for (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol is OC1NC2C[C@@H]3CC1C[C@@H](C2)C3.
What is the InChIKey of (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol?
The InChIKey is MAPYNHQXIRMQAC-JXSKLUPZSA-N. The full InChI is InChI=1S/C10H17NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-12H,1-5H2/t6-,7-,8?,9?,10?/m0/s1.
What are the key properties of (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol?
(1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol has a molecular weight of 167.25 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-4-azatricyclo[4.3.1.13,8]undecan-5-ol is sourced from PubChem (CID 55255541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).