About 4H-1,3-benzodioxin-7-ylmethanol
4H-1,3-benzodioxin-7-ylmethanol (PubChem CID 55255556) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4H-1,3-benzodioxin-7-ylmethanol.
Molecular Properties
| Compound Name | 4H-1,3-benzodioxin-7-ylmethanol |
| PubChem CID | 55255556 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4H-1,3-benzodioxin-7-ylmethanol |
| SMILES | OCc1ccc2c(c1)OCOC2 |
| InChI | InChI=1S/C9H10O3/c10-4-7-1-2-8-5-11-6-12-9(8)3-7/h1-3,10H,4-6H2 |
| InChIKey | LFIBAAVBULGYJD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-1,3-benzodioxin-7-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,3-benzodioxin-7-ylmethanol?
The IUPAC name of 4H-1,3-benzodioxin-7-ylmethanol (CID 55255556) is 4H-1,3-benzodioxin-7-ylmethanol.
What is the SMILES notation for 4H-1,3-benzodioxin-7-ylmethanol?
The canonical SMILES for 4H-1,3-benzodioxin-7-ylmethanol is OCc1ccc2c(c1)OCOC2.
What is the InChIKey of 4H-1,3-benzodioxin-7-ylmethanol?
The InChIKey is LFIBAAVBULGYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-4-7-1-2-8-5-11-6-12-9(8)3-7/h1-3,10H,4-6H2.
What are the key properties of 4H-1,3-benzodioxin-7-ylmethanol?
4H-1,3-benzodioxin-7-ylmethanol has a molecular weight of 166.18 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,3-benzodioxin-7-ylmethanol is sourced from PubChem (CID 55255556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).