About 2-(1,3-dioxolan-2-yl)benzene-1,4-diol
2-(1,3-dioxolan-2-yl)benzene-1,4-diol (PubChem CID 55255656) has the molecular formula C9H10O4
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)benzene-1,4-diol |
| PubChem CID | 55255656 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C2OCCO2)c1 |
| InChI | InChI=1S/C9H10O4/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-2,5,9-11H,3-4H2 |
| InChIKey | RBBISJVVPJBDPS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-2-yl)benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)benzene-1,4-diol?
The IUPAC name of 2-(1,3-dioxolan-2-yl)benzene-1,4-diol (CID 55255656) is 2-(1,3-dioxolan-2-yl)benzene-1,4-diol.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)benzene-1,4-diol?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)benzene-1,4-diol is Oc1ccc(O)c(C2OCCO2)c1.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)benzene-1,4-diol?
The InChIKey is RBBISJVVPJBDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-2,5,9-11H,3-4H2.
What are the key properties of 2-(1,3-dioxolan-2-yl)benzene-1,4-diol?
2-(1,3-dioxolan-2-yl)benzene-1,4-diol has a molecular weight of 182.18 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)benzene-1,4-diol is sourced from PubChem (CID 55255656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).