C9H8N2O2 — CID 55255707
7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione (PubChem CID 55255707) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione.
| Compound Name | 7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione |
|---|---|
| PubChem CID | 55255707 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 7,9-dihydro-6H-pyrido[2,3-b]azepine-5,8-dione |
| SMILES | O=C1CCC(=O)c2cccnc2N1 |
| InChI | InChI=1S/C9H8N2O2/c12-7-3-4-8(13)11-9-6(7)2-1-5-10-9/h1-2,5H,3-4H2,(H,10,11,13) |
| InChIKey | MMRNZOSYBOQWME-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |