About 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole
2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole (PubChem CID 55256103) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole |
| PubChem CID | 55256103 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole |
| SMILES | Cc1cc(C)c(C2OCCO2)[nH]1 |
| InChI | InChI=1S/C9H13NO2/c1-6-5-7(2)10-8(6)9-11-3-4-12-9/h5,9-10H,3-4H2,1-2H3 |
| InChIKey | ZBQRFMWGKOWQLG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole?
The IUPAC name of 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole (CID 55256103) is 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole is Cc1cc(C)c(C2OCCO2)[nH]1.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole?
The InChIKey is ZBQRFMWGKOWQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-6-5-7(2)10-8(6)9-11-3-4-12-9/h5,9-10H,3-4H2,1-2H3.
What are the key properties of 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole?
2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole has a molecular weight of 167.21 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)-3,5-dimethyl-1H-pyrrole is sourced from PubChem (CID 55256103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).