(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine

C15H18N2 — CID 55256587

IUPAC(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine
SMILESCc1ccnc(C(N)c2ccc(C)c(C)c2)c1
InChIInChI=1S/C15H18N2/c1-10-6-7-17-14(8-10)15(16)13-5-4-11(2)12(3)9-13/h4-9,15H,16H2,1-3H3
InChIKeyICMMXISHHSEOTJ-UHFFFAOYSA-N
MW226.32 g/mol
LogP3.05
Rot. Bonds2

About (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine

(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine (PubChem CID 55256587) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine.

Molecular Properties

Compound Name(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine
PubChem CID55256587
Molecular FormulaC15H18N2
Molecular Weight226.32 g/mol
Exact Mass226.15
IUPAC Name(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine
SMILESCc1ccnc(C(N)c2ccc(C)c(C)c2)c1
InChIInChI=1S/C15H18N2/c1-10-6-7-17-14(8-10)15(16)13-5-4-11(2)12(3)9-13/h4-9,15H,16H2,1-3H3
InChIKeyICMMXISHHSEOTJ-UHFFFAOYSA-N
XLogP3.05
TPSA38.91 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(4-methylphenyl)-(4-methyl-2-pyridinyl)methanamine
CID 63840530
(4-methyl-2-pyridinyl)-phenylmethanamine
CID 571849
(4-chloro-3-methoxyphenyl)-(4-methyl-2-pyridinyl)methanamine
CID 79699404
(2,5-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine
CID 63840951
(3,4-dimethylphenyl)-(5-methylpyrazin-2-yl)methanamine
CID 105140357
(3-chlorophenyl)-(4-methyl-2-pyridinyl)methanamine
CID 63839417
(1-methylpyrazol-4-yl)-(4-methyl-2-pyridinyl)methanamine
CID 63839914
(2,6-difluoro-3-methylphenyl)-(4-methyl-2-pyridinyl)methanamine
CID 82823215
(4-methyl-2-pyridinyl)-(4-methyl-3-pyridinyl)methanamine
CID 66271642
(3,4-dimethylphenyl)-[5-(trifluoromethyl)-2-pyridinyl]methanamine
CID 105140396
(3,4-dimethylphenyl)-(3,5-dimethylphenyl)methanamine
CID 43149143
(2-methoxy-3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine
CID 103433515

Frequently Asked Questions

What is the IUPAC name of (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine?
The IUPAC name of (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine (CID 55256587) is (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine.
What is the SMILES notation for (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine?
The canonical SMILES for (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine is Cc1ccnc(C(N)c2ccc(C)c(C)c2)c1.
What is the InChIKey of (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine?
The InChIKey is ICMMXISHHSEOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2/c1-10-6-7-17-14(8-10)15(16)13-5-4-11(2)12(3)9-13/h4-9,15H,16H2,1-3H3.
What are the key properties of (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine?
(3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine has a molecular weight of 226.32 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)-(4-methyl-2-pyridinyl)methanamine is sourced from PubChem (CID 55256587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).