C29H64O6S2Si4 — CID 552571
5-[1,2-bis(trimethylsilyloxy)ethyl]-2-(2-heptyl-1,3-dithian-2-yl)-3,4-bis(trimethylsilyloxy)oxolan-2-ol (PubChem CID 552571) has the molecular formula C29H64O6S2Si4 and a molecular weight of 685.30 g/mol. Its IUPAC name is 5-[1,2-bis(trimethylsilyloxy)ethyl]-2-(2-heptyl-1,3-dithian-2-yl)-3,4-bis(trimethylsilyloxy)oxolan-2-ol.
| Compound Name | 5-[1,2-bis(trimethylsilyloxy)ethyl]-2-(2-heptyl-1,3-dithian-2-yl)-3,4-bis(trimethylsilyloxy)oxolan-2-ol |
|---|---|
| PubChem CID | 552571 |
| Molecular Formula | C29H64O6S2Si4 |
| Molecular Weight | 685.30 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | 5-[1,2-bis(trimethylsilyloxy)ethyl]-2-(2-heptyl-1,3-dithian-2-yl)-3,4-bis(trimethylsilyloxy)oxolan-2-ol |
| SMILES | CCCCCCCC1(C2(O)OC(C(CO[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)SCCCS1 |
| InChI | InChI=1S/C29H64O6S2Si4/c1-14-15-16-17-18-20-28(36-21-19-22-37-28)29(30)27(35-41(11,12)13)26(34-40(8,9)10)25(32-29)24(33-39(5,6)7)23-31-38(2,3)4/h24-27,30H,14-23H2,1-13H3 |
| InChIKey | MIRXLOCHMMOSDQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.30 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|