C14H10N4S — CID 55258412
4-(1,3-thiazol-4-ylmethylamino)quinoline-3-carbonitrile (PubChem CID 55258412) has the molecular formula C14H10N4S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-ylmethylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(1,3-thiazol-4-ylmethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 55258412 |
| Molecular Formula | C14H10N4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-(1,3-thiazol-4-ylmethylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1NCc1cscn1 |
| InChI | InChI=1S/C14H10N4S/c15-5-10-6-16-13-4-2-1-3-12(13)14(10)17-7-11-8-19-9-18-11/h1-4,6,8-9H,7H2,(H,16,17) |
| InChIKey | LJDWLVPDQCVNSG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |