C15H20ClNO2 — CID 55258806
5-chloro-1-(3,3-diethoxypropyl)indole (PubChem CID 55258806) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 5-chloro-1-(3,3-diethoxypropyl)indole.
| Compound Name | 5-chloro-1-(3,3-diethoxypropyl)indole |
|---|---|
| PubChem CID | 55258806 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-chloro-1-(3,3-diethoxypropyl)indole |
| SMILES | CCOC(CCn1ccc2cc(Cl)ccc21)OCC |
| InChI | InChI=1S/C15H20ClNO2/c1-3-18-15(19-4-2)8-10-17-9-7-12-11-13(16)5-6-14(12)17/h5-7,9,11,15H,3-4,8,10H2,1-2H3 |
| InChIKey | LOCSJTSNELHNDZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|