About 2-formyl-N,N-dipropylpiperidine-1-sulfonamide
2-formyl-N,N-dipropylpiperidine-1-sulfonamide (PubChem CID 55258921) has the molecular formula C12H24N2O3S
and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-formyl-N,N-dipropylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 2-formyl-N,N-dipropylpiperidine-1-sulfonamide |
| PubChem CID | 55258921 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-formyl-N,N-dipropylpiperidine-1-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)N1CCCCC1C=O |
| InChI | InChI=1S/C12H24N2O3S/c1-3-8-13(9-4-2)18(16,17)14-10-6-5-7-12(14)11-15/h11-12H,3-10H2,1-2H3 |
| InChIKey | BESILDKQWSYJCH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-N,N-dipropylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-N,N-dipropylpiperidine-1-sulfonamide?
The IUPAC name of 2-formyl-N,N-dipropylpiperidine-1-sulfonamide (CID 55258921) is 2-formyl-N,N-dipropylpiperidine-1-sulfonamide.
What is the SMILES notation for 2-formyl-N,N-dipropylpiperidine-1-sulfonamide?
The canonical SMILES for 2-formyl-N,N-dipropylpiperidine-1-sulfonamide is CCCN(CCC)S(=O)(=O)N1CCCCC1C=O.
What is the InChIKey of 2-formyl-N,N-dipropylpiperidine-1-sulfonamide?
The InChIKey is BESILDKQWSYJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3S/c1-3-8-13(9-4-2)18(16,17)14-10-6-5-7-12(14)11-15/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-formyl-N,N-dipropylpiperidine-1-sulfonamide?
2-formyl-N,N-dipropylpiperidine-1-sulfonamide has a molecular weight of 276.40 g/mol, XLogP of 1.41, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-N,N-dipropylpiperidine-1-sulfonamide is sourced from PubChem (CID 55258921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).