C20H38O10 — CID 552595
2-(1,4,7,10,13-pentaoxacyclopentadec-2-yl)-1,4,7,10,13-pentaoxacyclopentadecane (PubChem CID 552595) has the molecular formula C20H38O10 and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(1,4,7,10,13-pentaoxacyclopentadec-2-yl)-1,4,7,10,13-pentaoxacyclopentadecane.
| Compound Name | 2-(1,4,7,10,13-pentaoxacyclopentadec-2-yl)-1,4,7,10,13-pentaoxacyclopentadecane |
|---|---|
| PubChem CID | 552595 |
| Molecular Formula | C20H38O10 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-(1,4,7,10,13-pentaoxacyclopentadec-2-yl)-1,4,7,10,13-pentaoxacyclopentadecane |
| SMILES | C1COCCOCC(C2COCCOCCOCCOCCO2)OCCOCCO1 |
| InChI | InChI=1S/C20H38O10/c1-3-23-9-11-27-17-19(29-15-13-25-7-5-21-1)20-18-28-12-10-24-4-2-22-6-8-26-14-16-30-20/h19-20H,1-18H2 |
| InChIKey | WTQWBJBCBVHRDF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |