C10H12ClF3N2O — CID 55260297
4-chloro-1-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine (PubChem CID 55260297) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is 4-chloro-1-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 55260297 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-chloro-1-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)ccc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2O/c11-7-1-2-9(8(15)5-7)16-3-4-17-6-10(12,13)14/h1-2,5,16H,3-4,6,15H2 |
| InChIKey | RWOZTOJEXJTNPP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|