C7H11F3N4O3S — CID 55260678
5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 55260678) has the molecular formula C7H11F3N4O3S and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55260678 |
| Molecular Formula | C7H11F3N4O3S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C7H11F3N4O3S/c8-7(9,10)4-17-2-1-13-18(15,16)5-3-12-14-6(5)11/h3,13H,1-2,4H2,(H3,11,12,14) |
| InChIKey | BWXOOVBFZZTENH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|