C10H15F3N4OS — CID 55260698
1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbothioamide (PubChem CID 55260698) has the molecular formula C10H15F3N4OS and a molecular weight of 296.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 55260698 |
| Molecular Formula | C10H15F3N4OS |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NCCOCC(F)(F)F)c1C(N)=S |
| InChI | InChI=1S/C10H15F3N4OS/c1-6-7(8(14)19)9(17(2)16-6)15-3-4-18-5-10(11,12)13/h15H,3-5H2,1-2H3,(H2,14,19) |
| InChIKey | AOKUYMVOBZBHGY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|