C16H23NO2 — CID 55260812
N-(3-acetylphenyl)-3,4,4-trimethylpentanamide (PubChem CID 55260812) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(3-acetylphenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 55260812 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(3-acetylphenyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H23NO2/c1-11(16(3,4)5)9-15(19)17-14-8-6-7-13(10-14)12(2)18/h6-8,10-11H,9H2,1-5H3,(H,17,19) |
| InChIKey | VBAUDRBVLLLIJX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |