C13H18N2O2S — CID 55261185
N-[(4-cyanophenyl)methyl]-3-methylbutane-1-sulfonamide (PubChem CID 55261185) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-3-methylbutane-1-sulfonamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 55261185 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H18N2O2S/c1-11(2)7-8-18(16,17)15-10-13-5-3-12(9-14)4-6-13/h3-6,11,15H,7-8,10H2,1-2H3 |
| InChIKey | KEYLHZBKVWCJEL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |