C24H46O12 — CID 552612
2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 552612) has the molecular formula C24H46O12 and a molecular weight of 526.62 g/mol. Its IUPAC name is 2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | 2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 552612 |
| Molecular Formula | C24H46O12 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | C1COCCOCCOC(C2COCCOCCOCCOCCOCCO2)COCCOCCO1 |
| InChI | InChI=1S/C24H46O12/c1-3-27-9-11-31-17-19-35-23(21-33-15-13-29-7-5-25-1)24-22-34-16-14-30-8-6-26-2-4-28-10-12-32-18-20-36-24/h23-24H,1-22H2 |
| InChIKey | CZDPQWDLIJKJBM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |