C7H8ClF3N2O3S2 — CID 55261268
2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide (PubChem CID 55261268) has the molecular formula C7H8ClF3N2O3S2 and a molecular weight of 324.73 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 55261268 |
| Molecular Formula | C7H8ClF3N2O3S2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)(F)F)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H8ClF3N2O3S2/c8-6-12-3-5(17-6)18(14,15)13-1-2-16-4-7(9,10)11/h3,13H,1-2,4H2 |
| InChIKey | HZANGJPXAZJZOM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|