C13H18F3NO2 — CID 55261468
2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 55261468) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 55261468 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | Cc1cc2c(n1CCOCC(F)(F)F)CCCC2O |
| InChI | InChI=1S/C13H18F3NO2/c1-9-7-10-11(3-2-4-12(10)18)17(9)5-6-19-8-13(14,15)16/h7,12,18H,2-6,8H2,1H3 |
| InChIKey | FKCLUBAGENMDDW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|