C15H20O2S — CID 55261503
1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxypropylsulfanyl)ethanone (PubChem CID 55261503) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxypropylsulfanyl)ethanone.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxypropylsulfanyl)ethanone |
|---|---|
| PubChem CID | 55261503 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(3-methoxypropylsulfanyl)ethanone |
| SMILES | COCCCSCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H20O2S/c1-17-8-3-9-18-11-15(16)14-7-6-12-4-2-5-13(12)10-14/h6-7,10H,2-5,8-9,11H2,1H3 |
| InChIKey | ZMCRYPNZZLFACJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|