About 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine
2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine (PubChem CID 55261534) has the molecular formula C12H23N3OS
and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine |
| PubChem CID | 55261534 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine |
| SMILES | CCOC(CN)CCN(C)Cc1scnc1C |
| InChI | InChI=1S/C12H23N3OS/c1-4-16-11(7-13)5-6-15(3)8-12-10(2)14-9-17-12/h9,11H,4-8,13H2,1-3H3 |
| InChIKey | PZDVLNRHPUOVPN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine?
The IUPAC name of 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine (CID 55261534) is 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine.
What is the SMILES notation for 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine?
The canonical SMILES for 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine is CCOC(CN)CCN(C)Cc1scnc1C.
What is the InChIKey of 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine?
The InChIKey is PZDVLNRHPUOVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OS/c1-4-16-11(7-13)5-6-15(3)8-12-10(2)14-9-17-12/h9,11H,4-8,13H2,1-3H3.
What are the key properties of 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine?
2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine has a molecular weight of 257.40 g/mol, XLogP of 1.64, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butane-1,4-diamine is sourced from PubChem (CID 55261534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).