C8H12F3N5O2 — CID 55261639
2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 55261639) has the molecular formula C8H12F3N5O2 and a molecular weight of 267.21 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55261639 |
| Molecular Formula | C8H12F3N5O2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | Nc1ncn(CC(=O)NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H12F3N5O2/c9-8(10,11)4-18-2-1-13-6(17)3-16-5-14-7(12)15-16/h5H,1-4H2,(H2,12,15)(H,13,17) |
| InChIKey | AVIBONFLUVQKFL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|