C12H18F3NO2 — CID 55261850
9-[2-(2,2,2-trifluoroethoxy)ethyl]-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 55261850) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 9-[2-(2,2,2-trifluoroethoxy)ethyl]-9-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | 9-[2-(2,2,2-trifluoroethoxy)ethyl]-9-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 55261850 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 9-[2-(2,2,2-trifluoroethoxy)ethyl]-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1CC2CCCC(C1)N2CCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NO2/c13-12(14,15)8-18-5-4-16-9-2-1-3-10(16)7-11(17)6-9/h9-10H,1-8H2 |
| InChIKey | PJDACROCYUQTHL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|