About 3-piperidin-4-yl-1,2-oxazole
3-piperidin-4-yl-1,2-oxazole (PubChem CID 55262740) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-piperidin-4-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-piperidin-4-yl-1,2-oxazole |
| PubChem CID | 55262740 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-piperidin-4-yl-1,2-oxazole |
| SMILES | c1cc(C2CCNCC2)no1 |
| InChI | InChI=1S/C8H12N2O/c1-4-9-5-2-7(1)8-3-6-11-10-8/h3,6-7,9H,1-2,4-5H2 |
| InChIKey | KGDGSULSAJSJRK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-piperidin-4-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-yl-1,2-oxazole?
The IUPAC name of 3-piperidin-4-yl-1,2-oxazole (CID 55262740) is 3-piperidin-4-yl-1,2-oxazole.
What is the SMILES notation for 3-piperidin-4-yl-1,2-oxazole?
The canonical SMILES for 3-piperidin-4-yl-1,2-oxazole is c1cc(C2CCNCC2)no1.
What is the InChIKey of 3-piperidin-4-yl-1,2-oxazole?
The InChIKey is KGDGSULSAJSJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-4-9-5-2-7(1)8-3-6-11-10-8/h3,6-7,9H,1-2,4-5H2.
What are the key properties of 3-piperidin-4-yl-1,2-oxazole?
3-piperidin-4-yl-1,2-oxazole has a molecular weight of 152.20 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-yl-1,2-oxazole is sourced from PubChem (CID 55262740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).