About ethyl 2-(1,3-oxazol-2-yl)acetate
ethyl 2-(1,3-oxazol-2-yl)acetate (PubChem CID 55263081) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is ethyl 2-(1,3-oxazol-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-oxazol-2-yl)acetate |
| PubChem CID | 55263081 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | ethyl 2-(1,3-oxazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1ncco1 |
| InChI | InChI=1S/C7H9NO3/c1-2-10-7(9)5-6-8-3-4-11-6/h3-4H,2,5H2,1H3 |
| InChIKey | FXWLQNCICFITCB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(1,3-oxazol-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-oxazol-2-yl)acetate?
The IUPAC name of ethyl 2-(1,3-oxazol-2-yl)acetate (CID 55263081) is ethyl 2-(1,3-oxazol-2-yl)acetate.
What is the SMILES notation for ethyl 2-(1,3-oxazol-2-yl)acetate?
The canonical SMILES for ethyl 2-(1,3-oxazol-2-yl)acetate is CCOC(=O)Cc1ncco1.
What is the InChIKey of ethyl 2-(1,3-oxazol-2-yl)acetate?
The InChIKey is FXWLQNCICFITCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-2-10-7(9)5-6-8-3-4-11-6/h3-4H,2,5H2,1H3.
What are the key properties of ethyl 2-(1,3-oxazol-2-yl)acetate?
ethyl 2-(1,3-oxazol-2-yl)acetate has a molecular weight of 155.15 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-oxazol-2-yl)acetate is sourced from PubChem (CID 55263081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).