About 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol
6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol (PubChem CID 55263388) has the molecular formula C10H12ClNO
and a molecular weight of 197.66 g/mol. Its IUPAC name is 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol.
Molecular Properties
| Compound Name | 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol |
| PubChem CID | 55263388 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol |
| SMILES | Cc1c(Cl)cc([C@H]2CN2)c(O)c1C |
| InChI | InChI=1S/C10H12ClNO/c1-5-6(2)10(13)7(3-8(5)11)9-4-12-9/h3,9,12-13H,4H2,1-2H3/t9-/m1/s1 |
| InChIKey | CWPGBTRLGVREAD-SECBINFHSA-N |
| XLogP | 2.31 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol?
The IUPAC name of 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol (CID 55263388) is 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol.
What is the SMILES notation for 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol?
The canonical SMILES for 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol is Cc1c(Cl)cc([C@H]2CN2)c(O)c1C.
What is the InChIKey of 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol?
The InChIKey is CWPGBTRLGVREAD-SECBINFHSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-5-6(2)10(13)7(3-8(5)11)9-4-12-9/h3,9,12-13H,4H2,1-2H3/t9-/m1/s1.
What are the key properties of 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol?
6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol has a molecular weight of 197.66 g/mol, XLogP of 2.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-aziridin-2-yl]-4-chloro-2,3-dimethylphenol is sourced from PubChem (CID 55263388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).