C10H11N3 — CID 55264669
4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene (PubChem CID 55264669) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene.
| Compound Name | 4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
|---|---|
| PubChem CID | 55264669 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
| SMILES | c1ccn2nc3c(c2c1)CNCC3 |
| InChI | InChI=1S/C10H11N3/c1-2-6-13-10(3-1)8-7-11-5-4-9(8)12-13/h1-3,6,11H,4-5,7H2 |
| InChIKey | LHYDJZJUHTWNOS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |