C11H15N — CID 55264670
7-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 55264670) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 7-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 55264670 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 7-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | Cc1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C11H15N/c1-9-2-3-10-4-6-12-7-5-11(10)8-9/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | BYJSJCINJQCMSR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |